C25H18Cl4O — CID 98121138
(1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,3,6-triphenyl-2-oxatricyclo[5.1.0.03,5]octane (PubChem CID 98121138) has the molecular formula C25H18Cl4O and a molecular weight of 476.23 g/mol. Its IUPAC name is (1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,3,6-triphenyl-2-oxatricyclo[5.1.0.03,5]octane.
| Compound Name | (1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,3,6-triphenyl-2-oxatricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 98121138 |
| Molecular Formula | C25H18Cl4O |
| Molecular Weight | 476.23 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | (1S,3S,5R,7R)-4,4,8,8-tetrachloro-1,3,6-triphenyl-2-oxatricyclo[5.1.0.03,5]octane |
| SMILES | ClC1(Cl)[C@@H]2C(c3ccccc3)[C@H]3C(Cl)(Cl)[C@]3(c3ccccc3)O[C@]21c1ccccc1 |
| InChI | InChI=1S/C25H18Cl4O/c26-24(27)20-19(16-10-4-1-5-11-16)21-23(25(21,28)29,18-14-8-3-9-15-18)30-22(20,24)17-12-6-2-7-13-17/h1-15,19-21H/t20-,21-,22-,23-/m1/s1 |
| InChIKey | ARIVSUNOHKGQHS-SSGKUCQKSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.23 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|