C30H21Cl2NO3 — CID 11145694
methyl (1S,8R,10R,11S)-10-(2,6-dichlorophenyl)-1,8-diphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene-11-carboxylate (PubChem CID 11145694) has the molecular formula C30H21Cl2NO3 and a molecular weight of 514.41 g/mol. Its IUPAC name is methyl (1S,8R,10R,11S)-10-(2,6-dichlorophenyl)-1,8-diphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene-11-carboxylate.
| Compound Name | methyl (1S,8R,10R,11S)-10-(2,6-dichlorophenyl)-1,8-diphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 11145694 |
| Molecular Formula | C30H21Cl2NO3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | methyl (1S,8R,10R,11S)-10-(2,6-dichlorophenyl)-1,8-diphenyl-12-oxa-9-azatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene-11-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H](c3c(Cl)cccc3Cl)N1[C@]1(c3ccccc3)O[C@@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H21Cl2NO3/c1-35-27(34)28-26(25-23(31)17-10-18-24(25)32)33(28)30(20-13-6-3-7-14-20)22-16-9-8-15-21(22)29(28,36-30)19-11-4-2-5-12-19/h2-18,26H,1H3/t26-,28-,29+,30-,33?/m1/s1 |
| InChIKey | VQBQKXGJXINFLM-WCASGKMISA-N |
| XLogP | 6.45 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|