C26H23NO3 — CID 11315472
methyl (1R,8S,9S,13S)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-9-carboxylate (PubChem CID 11315472) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is methyl (1R,8S,9S,13S)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-9-carboxylate.
| Compound Name | methyl (1R,8S,9S,13S)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 11315472 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl (1R,8S,9S,13S)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-9-carboxylate |
| SMILES | COC(=O)[C@]12CNC[C@H]1[C@]1(c3ccccc3)O[C@@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H23NO3/c1-29-23(28)24-17-27-16-22(24)25(18-10-4-2-5-11-18)20-14-8-9-15-21(20)26(24,30-25)19-12-6-3-7-13-19/h2-15,22,27H,16-17H2,1H3/t22-,24+,25-,26+/m1/s1 |
| InChIKey | RDNHLKXKUDLBJT-DSYNPFFXSA-N |
| XLogP | 3.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |