C24H25NO4 — CID 139890131
methyl 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate (PubChem CID 139890131) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is methyl 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate.
| Compound Name | methyl 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 139890131 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | methyl 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate |
| SMILES | COC(=O)C12CNCC1C1(c3ccc4c(c3)OCCO4)CCC2c2ccccc21 |
| InChI | InChI=1S/C24H25NO4/c1-27-22(26)24-14-25-13-21(24)23(9-8-18(24)16-4-2-3-5-17(16)23)15-6-7-19-20(12-15)29-11-10-28-19/h2-7,12,18,21,25H,8-11,13-14H2,1H3 |
| InChIKey | CFXPPKZUTAITCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |