C32H31NO4 — CID 10529197
methyl (1R,8R,9R,13R)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate (PubChem CID 10529197) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl (1R,8R,9R,13R)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate.
| Compound Name | methyl (1R,8R,9R,13R)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 10529197 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | methyl (1R,8R,9R,13R)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate |
| SMILES | C=C(C(=O)N1C[C@@H]2[C@@]3(c4ccccc4)CC[C@H](c4ccccc43)[C@]2(C(=O)OC)C1)c1ccccc1OC |
| InChI | InChI=1S/C32H31NO4/c1-21(23-13-8-10-16-27(23)36-2)29(34)33-19-28-31(22-11-5-4-6-12-22)18-17-26(24-14-7-9-15-25(24)31)32(28,20-33)30(35)37-3/h4-16,26,28H,1,17-20H2,2-3H3/t26-,28-,31-,32-/m1/s1 |
| InChIKey | UPOILHQLOGLMSQ-FUAPVUPJSA-N |
| XLogP | 5.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|