C32H29Cl2NO4 — CID 139941647
methyl 1-(2,4-dichlorophenyl)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate (PubChem CID 139941647) has the molecular formula C32H29Cl2NO4 and a molecular weight of 562.49 g/mol. Its IUPAC name is methyl 1-(2,4-dichlorophenyl)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate.
| Compound Name | methyl 1-(2,4-dichlorophenyl)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 139941647 |
| Molecular Formula | C32H29Cl2NO4 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | methyl 1-(2,4-dichlorophenyl)-11-[2-(2-methoxyphenyl)prop-2-enoyl]-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxylate |
| SMILES | C=C(C(=O)N1CC2C3(c4ccc(Cl)cc4Cl)CCC(c4ccccc43)C2(C(=O)OC)C1)c1ccccc1OC |
| InChI | InChI=1S/C32H29Cl2NO4/c1-19(21-8-5-7-11-27(21)38-2)29(36)35-17-28-31(25-13-12-20(33)16-26(25)34)15-14-24(22-9-4-6-10-23(22)31)32(28,18-35)30(37)39-3/h4-13,16,24,28H,1,14-15,17-18H2,2-3H3 |
| InChIKey | VQAFBRYPMHTQDB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|