C31H32N2O4 — CID 10505435
(1R,8R,9R,13R)-N-methoxy-11-[2-(2-methoxyphenyl)acetyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide (PubChem CID 10505435) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is (1R,8R,9R,13R)-N-methoxy-11-[2-(2-methoxyphenyl)acetyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide.
| Compound Name | (1R,8R,9R,13R)-N-methoxy-11-[2-(2-methoxyphenyl)acetyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide |
|---|---|
| PubChem CID | 10505435 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (1R,8R,9R,13R)-N-methoxy-11-[2-(2-methoxyphenyl)acetyl]-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide |
| SMILES | CONC(=O)[C@@]12CN(C(=O)Cc3ccccc3OC)C[C@@H]1[C@@]1(c3ccccc3)CC[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C31H32N2O4/c1-36-26-15-9-6-10-21(26)18-28(34)33-19-27-30(22-11-4-3-5-12-22)17-16-25(23-13-7-8-14-24(23)30)31(27,20-33)29(35)32-37-2/h3-15,25,27H,16-20H2,1-2H3,(H,32,35)/t25-,27-,30-,31-/m1/s1 |
| InChIKey | JPYDRCUDZCZXCQ-RSQMPJMXSA-N |
| XLogP | 4.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|