C37H35N3O3 — CID 67581104
(1R,8R,9S,13S)-11-[3-(4-methoxyphenyl)prop-2-enoyl]-1-phenyl-N-(pyridin-3-ylmethyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide (PubChem CID 67581104) has the molecular formula C37H35N3O3 and a molecular weight of 569.71 g/mol. Its IUPAC name is (1R,8R,9S,13S)-11-[3-(4-methoxyphenyl)prop-2-enoyl]-1-phenyl-N-(pyridin-3-ylmethyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide.
| Compound Name | (1R,8R,9S,13S)-11-[3-(4-methoxyphenyl)prop-2-enoyl]-1-phenyl-N-(pyridin-3-ylmethyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide |
|---|---|
| PubChem CID | 67581104 |
| Molecular Formula | C37H35N3O3 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | (1R,8R,9S,13S)-11-[3-(4-methoxyphenyl)prop-2-enoyl]-1-phenyl-N-(pyridin-3-ylmethyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-carboxamide |
| SMILES | COc1ccc(C=CC(=O)N2C[C@H]3[C@@]4(c5ccccc5)CC[C@H](c5ccccc54)[C@@]3(C(=O)NCc3cccnc3)C2)cc1 |
| InChI | InChI=1S/C37H35N3O3/c1-43-29-16-13-26(14-17-29)15-18-34(41)40-24-33-36(28-9-3-2-4-10-28)20-19-32(30-11-5-6-12-31(30)36)37(33,25-40)35(42)39-23-27-8-7-21-38-22-27/h2-18,21-22,32-33H,19-20,23-25H2,1H3,(H,39,42)/t32-,33+,36-,37+/m1/s1 |
| InChIKey | XNQIABDSHTYCBK-SWCRAJNGSA-N |
| XLogP | 5.74 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|