About 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one
1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one (PubChem CID 54545713) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one.
Molecular Properties
| Compound Name | 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one |
| PubChem CID | 54545713 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one |
| SMILES | C=C[C@]1(C)CC[C@@H](CC(=O)C[C@@H]2CC[C@@](C)(C=C)O2)O1 |
| InChI | InChI=1S/C17H26O3/c1-5-16(3)9-7-14(19-16)11-13(18)12-15-8-10-17(4,6-2)20-15/h5-6,14-15H,1-2,7-12H2,3-4H3/t14-,15-,16+,17+/m0/s1 |
| InChIKey | ZGJWHBVWMWYBIL-MWDXBVQZSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one?
The IUPAC name of 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one (CID 54545713) is 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one.
What is the SMILES notation for 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one?
The canonical SMILES for 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one is C=C[C@]1(C)CC[C@@H](CC(=O)C[C@@H]2CC[C@@](C)(C=C)O2)O1.
What is the InChIKey of 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one?
The InChIKey is ZGJWHBVWMWYBIL-MWDXBVQZSA-N. The full InChI is InChI=1S/C17H26O3/c1-5-16(3)9-7-14(19-16)11-13(18)12-15-8-10-17(4,6-2)20-15/h5-6,14-15H,1-2,7-12H2,3-4H3/t14-,15-,16+,17+/m0/s1.
What are the key properties of 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one?
1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one has a molecular weight of 278.39 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[(2S,5S)-5-ethenyl-5-methyloxolan-2-yl]propan-2-one is sourced from PubChem (CID 54545713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).