C14H26O2 — CID 141019728
3,4-dibutoxyhexa-2,4-diene (PubChem CID 141019728) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 3,4-dibutoxyhexa-2,4-diene.
| Compound Name | 3,4-dibutoxyhexa-2,4-diene |
|---|---|
| PubChem CID | 141019728 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3,4-dibutoxyhexa-2,4-diene |
| SMILES | CC=C(OCCCC)C(=CC)OCCCC |
| InChI | InChI=1S/C14H26O2/c1-5-9-11-15-13(7-3)14(8-4)16-12-10-6-2/h7-8H,5-6,9-12H2,1-4H3 |
| InChIKey | YALFCJKGTOMKBF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|