C11H17F2NO — CID 142883594
(Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine (PubChem CID 142883594) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is (Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine.
| Compound Name | (Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine |
|---|---|
| PubChem CID | 142883594 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine |
| SMILES | C#CC/C=C(\OCC)C(N)C(F)(F)CC |
| InChI | InChI=1S/C11H17F2NO/c1-4-7-8-9(15-6-3)10(14)11(12,13)5-2/h1,8,10H,5-7,14H2,2-3H3/b9-8- |
| InChIKey | BCZZUAYZDVISKK-HJWRWDBZSA-N |
| XLogP | 2.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|