C9H15F2NO — CID 142810445
(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine (PubChem CID 142810445) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is (5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine.
| Compound Name | (5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 142810445 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine |
| SMILES | C=CC(F)(F)C(N)/C(=C/C)OCC |
| InChI | InChI=1S/C9H15F2NO/c1-4-7(13-6-3)8(12)9(10,11)5-2/h4-5,8H,2,6,12H2,1,3H3/b7-4- |
| InChIKey | RIJDSKOVNGIQGH-DAXSKMNVSA-N |
| XLogP | 2.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|