C12H29NO — CID 178063295
(E,2S)-3-(2-ethylbutoxy)pent-3-en-2-amine;methane;molecular hydrogen (PubChem CID 178063295) has the molecular formula C12H29NO and a molecular weight of 203.37 g/mol. Its IUPAC name is (E,2S)-3-(2-ethylbutoxy)pent-3-en-2-amine;methane;molecular hydrogen.
| Compound Name | (E,2S)-3-(2-ethylbutoxy)pent-3-en-2-amine;methane;molecular hydrogen |
|---|---|
| PubChem CID | 178063295 |
| Molecular Formula | C12H29NO |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | (E,2S)-3-(2-ethylbutoxy)pent-3-en-2-amine;methane;molecular hydrogen |
| SMILES | C.C/C=C(/OCC(CC)CC)[C@H](C)N.[H][H] |
| InChI | InChI=1S/C11H23NO.CH4.H2/c1-5-10(6-2)8-13-11(7-3)9(4)12;;/h7,9-10H,5-6,8,12H2,1-4H3;1H4;1H/b11-7+;;/t9-;;/m0../s1 |
| InChIKey | UNFLFMHCKIAVFB-BJDNOSHRSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|