C14H29NO — CID 142856850
ethane;(Z,3R)-4-ethenoxy-7-methylnon-4-en-3-amine (PubChem CID 142856850) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is ethane;(Z,3R)-4-ethenoxy-7-methylnon-4-en-3-amine.
| Compound Name | ethane;(Z,3R)-4-ethenoxy-7-methylnon-4-en-3-amine |
|---|---|
| PubChem CID | 142856850 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | ethane;(Z,3R)-4-ethenoxy-7-methylnon-4-en-3-amine |
| SMILES | C=CO/C(=C\CC(C)CC)[C@H](N)CC.CC |
| InChI | InChI=1S/C12H23NO.C2H6/c1-5-10(4)8-9-12(14-7-3)11(13)6-2;1-2/h7,9-11H,3,5-6,8,13H2,1-2,4H3;1-2H3/b12-9-;/t10?,11-;/m1./s1 |
| InChIKey | XXEKYBUVPXIMOE-DAYGZBEFSA-N |
| XLogP | 4.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|