C15H29NO — CID 143080311
(Z,3R)-2,2,7,7-tetramethyl-4-[(Z)-prop-1-enoxy]oct-4-en-3-amine (PubChem CID 143080311) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (Z,3R)-2,2,7,7-tetramethyl-4-[(Z)-prop-1-enoxy]oct-4-en-3-amine.
| Compound Name | (Z,3R)-2,2,7,7-tetramethyl-4-[(Z)-prop-1-enoxy]oct-4-en-3-amine |
|---|---|
| PubChem CID | 143080311 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (Z,3R)-2,2,7,7-tetramethyl-4-[(Z)-prop-1-enoxy]oct-4-en-3-amine |
| SMILES | C/C=C\O/C(=C\CC(C)(C)C)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H29NO/c1-8-11-17-12(9-10-14(2,3)4)13(16)15(5,6)7/h8-9,11,13H,10,16H2,1-7H3/b11-8-,12-9-/t13-/m0/s1 |
| InChIKey | DGHWOAWZFRIROL-FPGVHIETSA-N |
| XLogP | 4.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|