C10H11BrCl2O2 — CID 134396333
(2E,4E)-3-bromo-5-chloro-2-[(Z)-1-chlorobut-1-enyl]hexa-2,4-dienoic acid (PubChem CID 134396333) has the molecular formula C10H11BrCl2O2 and a molecular weight of 314.01 g/mol. Its IUPAC name is (2E,4E)-3-bromo-5-chloro-2-[(Z)-1-chlorobut-1-enyl]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-bromo-5-chloro-2-[(Z)-1-chlorobut-1-enyl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 134396333 |
| Molecular Formula | C10H11BrCl2O2 |
| Molecular Weight | 314.01 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | (2E,4E)-3-bromo-5-chloro-2-[(Z)-1-chlorobut-1-enyl]hexa-2,4-dienoic acid |
| SMILES | CC/C=C(Cl)/C(C(=O)O)=C(Br)\C=C(/C)Cl |
| InChI | InChI=1S/C10H11BrCl2O2/c1-3-4-8(13)9(10(14)15)7(11)5-6(2)12/h4-5H,3H2,1-2H3,(H,14,15)/b6-5+,8-4-,9-7- |
| InChIKey | YWGKSJQJOROEFS-VUYYVXKKSA-N |
| XLogP | 4.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|