C15H27NO2 — CID 161106625
(E)-6-(dimethylamino)-2-methylhex-4-en-3-one;4-methylpent-1-en-3-one (PubChem CID 161106625) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (E)-6-(dimethylamino)-2-methylhex-4-en-3-one;4-methylpent-1-en-3-one.
| Compound Name | (E)-6-(dimethylamino)-2-methylhex-4-en-3-one;4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 161106625 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (E)-6-(dimethylamino)-2-methylhex-4-en-3-one;4-methylpent-1-en-3-one |
| SMILES | C=CC(=O)C(C)C.CC(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C9H17NO.C6H10O/c1-8(2)9(11)6-5-7-10(3)4;1-4-6(7)5(2)3/h5-6,8H,7H2,1-4H3;4-5H,1H2,2-3H3/b6-5+; |
| InChIKey | UJDCQCYPLIWYTC-IPZCTEOASA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|