C10H18N2O3 — CID 167020342
N-hydroxy-2-[methyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]acetamide (PubChem CID 167020342) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]acetamide.
| Compound Name | N-hydroxy-2-[methyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]acetamide |
|---|---|
| PubChem CID | 167020342 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-hydroxy-2-[methyl-[(E)-5-methyl-4-oxohex-2-enyl]amino]acetamide |
| SMILES | CC(C)C(=O)/C=C/CN(C)CC(=O)NO |
| InChI | InChI=1S/C10H18N2O3/c1-8(2)9(13)5-4-6-12(3)7-10(14)11-15/h4-5,8,15H,6-7H2,1-3H3,(H,11,14)/b5-4+ |
| InChIKey | RIUKHEDXFAILOA-SNAWJCMRSA-N |
| XLogP | 0.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|