C11H20N2O2 — CID 142388322
N,N-dimethyl-2-[methyl-[(E)-4-oxohex-2-enyl]amino]acetamide (PubChem CID 142388322) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N,N-dimethyl-2-[methyl-[(E)-4-oxohex-2-enyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[methyl-[(E)-4-oxohex-2-enyl]amino]acetamide |
|---|---|
| PubChem CID | 142388322 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N,N-dimethyl-2-[methyl-[(E)-4-oxohex-2-enyl]amino]acetamide |
| SMILES | CCC(=O)/C=C/CN(C)CC(=O)N(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-5-10(14)7-6-8-13(4)9-11(15)12(2)3/h6-7H,5,8-9H2,1-4H3/b7-6+ |
| InChIKey | UXPLYXCYKHUVJE-VOTSOKGWSA-N |
| XLogP | 0.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|