C8H17N3O — CID 146735988
N,N-dimethyl-2-[methyl(propanimidoyl)amino]acetamide (PubChem CID 146735988) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is N,N-dimethyl-2-[methyl(propanimidoyl)amino]acetamide.
| Compound Name | N,N-dimethyl-2-[methyl(propanimidoyl)amino]acetamide |
|---|---|
| PubChem CID | 146735988 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N,N-dimethyl-2-[methyl(propanimidoyl)amino]acetamide |
| SMILES | [H]/N=C(\CC)N(C)CC(=O)N(C)C |
| InChI | InChI=1S/C8H17N3O/c1-5-7(9)11(4)6-8(12)10(2)3/h9H,5-6H2,1-4H3/b9-7+ |
| InChIKey | RJDYYTFHHPNBNH-VQHVLOKHSA-N |
| XLogP | 0.39 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|