About N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide
N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide (PubChem CID 130272423) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide |
| PubChem CID | 130272423 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide |
| SMILES | CCC(C)(C)CC(=O)N(C)CC(=O)N(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-7-12(2,3)8-10(15)14(6)9-11(16)13(4)5/h7-9H2,1-6H3 |
| InChIKey | ZIIVMVJHCJRNFI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide?
The IUPAC name of N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide (CID 130272423) is N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide.
What is the SMILES notation for N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide?
The canonical SMILES for N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide is CCC(C)(C)CC(=O)N(C)CC(=O)N(C)C.
What is the InChIKey of N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide?
The InChIKey is ZIIVMVJHCJRNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-7-12(2,3)8-10(15)14(6)9-11(16)13(4)5/h7-9H2,1-6H3.
What are the key properties of N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide?
N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide has a molecular weight of 228.34 g/mol, XLogP of 1.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)-2-oxoethyl]-N,3,3-trimethylpentanamide is sourced from PubChem (CID 130272423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).