C10H20N2O2 — CID 130272316
N,3,3-trimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide (PubChem CID 130272316) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N,3,3-trimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide.
| Compound Name | N,3,3-trimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 130272316 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N,3,3-trimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide |
| SMILES | CNC(=O)CN(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)6-9(14)12(5)7-8(13)11-4/h6-7H2,1-5H3,(H,11,13) |
| InChIKey | KLFUSVAICPZGLE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |