C9H19N3O2 — CID 76929143
N-(2-amino-2-hydroxyiminoethyl)-N,3,3-trimethylbutanamide (PubChem CID 76929143) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-N,3,3-trimethylbutanamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 76929143 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-N,3,3-trimethylbutanamide |
| SMILES | CN(CC(N)=NO)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C9H19N3O2/c1-9(2,3)5-8(13)12(4)6-7(10)11-14/h14H,5-6H2,1-4H3,(H2,10,11) |
| InChIKey | OUEQIRDPNQGOAN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|