About N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide
N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide (PubChem CID 76928995) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide |
| PubChem CID | 76928995 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide |
| SMILES | CN(CC(N)=NO)C(=O)C(C)(C)C |
| InChI | InChI=1S/C8H17N3O2/c1-8(2,3)7(12)11(4)5-6(9)10-13/h13H,5H2,1-4H3,(H2,9,10) |
| InChIKey | IASDBAHYUIJFHK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide?
The IUPAC name of N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide (CID 76928995) is N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide?
The canonical SMILES for N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide is CN(CC(N)=NO)C(=O)C(C)(C)C.
What is the InChIKey of N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide?
The InChIKey is IASDBAHYUIJFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-8(2,3)7(12)11(4)5-6(9)10-13/h13H,5H2,1-4H3,(H2,9,10).
What are the key properties of N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide?
N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide has a molecular weight of 187.24 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-hydroxyiminoethyl)-N,2,2-trimethylpropanamide is sourced from PubChem (CID 76928995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).