C7H14N2O3 — CID 60652010
ethyl N-methyl-N-[2-(methylamino)-2-oxoethyl]carbamate (PubChem CID 60652010) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is ethyl N-methyl-N-[2-(methylamino)-2-oxoethyl]carbamate.
| Compound Name | ethyl N-methyl-N-[2-(methylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 60652010 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | ethyl N-methyl-N-[2-(methylamino)-2-oxoethyl]carbamate |
| SMILES | CCOC(=O)N(C)CC(=O)NC |
| InChI | InChI=1S/C7H14N2O3/c1-4-12-7(11)9(3)5-6(10)8-2/h4-5H2,1-3H3,(H,8,10) |
| InChIKey | POYDVLDPTZRUKE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |