C7H15N3O2 — CID 43375282
2-amino-N-methyl-N-[2-(methylamino)-2-oxoethyl]propanamide (PubChem CID 43375282) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[2-(methylamino)-2-oxoethyl]propanamide.
| Compound Name | 2-amino-N-methyl-N-[2-(methylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 43375282 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-amino-N-methyl-N-[2-(methylamino)-2-oxoethyl]propanamide |
| SMILES | CNC(=O)CN(C)C(=O)C(C)N |
| InChI | InChI=1S/C7H15N3O2/c1-5(8)7(12)10(3)4-6(11)9-2/h5H,4,8H2,1-3H3,(H,9,11) |
| InChIKey | PXLAZRHDWBGZBP-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |