C7H17N3O — CID 131227452
2-[[(2R)-1-aminopropan-2-yl]-methylamino]-N-methylacetamide (PubChem CID 131227452) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-[[(2R)-1-aminopropan-2-yl]-methylamino]-N-methylacetamide.
| Compound Name | 2-[[(2R)-1-aminopropan-2-yl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 131227452 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 2-[[(2R)-1-aminopropan-2-yl]-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)[C@H](C)CN |
| InChI | InChI=1S/C7H17N3O/c1-6(4-8)10(3)5-7(11)9-2/h6H,4-5,8H2,1-3H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | PPQCHPWPBRYPBQ-ZCFIWIBFSA-N |
| XLogP | -0.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |