C8H17N3OS — CID 60913837
2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N-methylacetamide (PubChem CID 60913837) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N-methylacetamide.
| Compound Name | 2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 60913837 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)C(C)CC(N)=S |
| InChI | InChI=1S/C8H17N3OS/c1-6(4-7(9)13)11(3)5-8(12)10-2/h6H,4-5H2,1-3H3,(H2,9,13)(H,10,12) |
| InChIKey | BOWICKAGJUBQNH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|