C7H14N2O3 — CID 43216485
2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanoic acid (PubChem CID 43216485) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43216485 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CNC(=O)CN(C)C(C)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-5(7(11)12)9(3)4-6(10)8-2/h5H,4H2,1-3H3,(H,8,10)(H,11,12) |
| InChIKey | RYEFNVXFKCRLPK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |