C10H19N3O4 — CID 55097076
2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-methylamino]propanoic acid (PubChem CID 55097076) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-methylamino]propanoic acid.
| Compound Name | 2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 55097076 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-methylamino]propanoic acid |
| SMILES | CCN(CC(=O)NC)C(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C10H19N3O4/c1-5-13(6-8(14)11-3)10(17)12(4)7(2)9(15)16/h7H,5-6H2,1-4H3,(H,11,14)(H,15,16) |
| InChIKey | HYGZOKXSUQDJLK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |