C9H18N2O2S — CID 94170765
(2R)-N-ethyl-N-[2-(methylamino)-2-oxoethyl]-2-methylsulfanylpropanamide (PubChem CID 94170765) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is (2R)-N-ethyl-N-[2-(methylamino)-2-oxoethyl]-2-methylsulfanylpropanamide.
| Compound Name | (2R)-N-ethyl-N-[2-(methylamino)-2-oxoethyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 94170765 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2R)-N-ethyl-N-[2-(methylamino)-2-oxoethyl]-2-methylsulfanylpropanamide |
| SMILES | CCN(CC(=O)NC)C(=O)[C@@H](C)SC |
| InChI | InChI=1S/C9H18N2O2S/c1-5-11(6-8(12)10-3)9(13)7(2)14-4/h7H,5-6H2,1-4H3,(H,10,12)/t7-/m1/s1 |
| InChIKey | FAXOYGJAYLJBFH-SSDOTTSWSA-N |
| XLogP | 0.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |