C13H24N4O4 — CID 62312294
2-[4-[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]piperazin-1-yl]propanoic acid (PubChem CID 62312294) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[4-[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]piperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 62312294 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[4-[ethyl-[2-(methylamino)-2-oxoethyl]carbamoyl]piperazin-1-yl]propanoic acid |
| SMILES | CCN(CC(=O)NC)C(=O)N1CCN(C(C)C(=O)O)CC1 |
| InChI | InChI=1S/C13H24N4O4/c1-4-15(9-11(18)14-3)13(21)17-7-5-16(6-8-17)10(2)12(19)20/h10H,4-9H2,1-3H3,(H,14,18)(H,19,20) |
| InChIKey | GUOAPZIRPAGZHN-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |