C10H20N4O3 — CID 78825733
N-(ethylcarbamoyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide (PubChem CID 78825733) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 78825733 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[methyl-[2-(methylamino)-2-oxoethyl]amino]propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)N(C)CC(=O)NC |
| InChI | InChI=1S/C10H20N4O3/c1-5-12-10(17)13-9(16)7(2)14(4)6-8(15)11-3/h7H,5-6H2,1-4H3,(H,11,15)(H2,12,13,16,17) |
| InChIKey | ZQEWMPLIMIWMTE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |