C11H21ClN2O3 — CID 119913701
2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119913701) has the molecular formula C11H21ClN2O3 and a molecular weight of 264.75 g/mol. Its IUPAC name is 2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913701 |
| Molecular Formula | C11H21ClN2O3 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[[2-(cyclopentylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CC(=O)NC1CCCC1.Cl |
| InChI | InChI=1S/C11H20N2O3.ClH/c1-8(11(15)16)13(2)7-10(14)12-9-5-3-4-6-9;/h8-9H,3-7H2,1-2H3,(H,12,14)(H,15,16);1H |
| InChIKey | RBKKUXPYDMMHJN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |