C9H21N3O — CID 104556890
4-[1-aminopropan-2-yl(methyl)amino]-N-methylbutanamide (PubChem CID 104556890) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-[1-aminopropan-2-yl(methyl)amino]-N-methylbutanamide.
| Compound Name | 4-[1-aminopropan-2-yl(methyl)amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 104556890 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 4-[1-aminopropan-2-yl(methyl)amino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCN(C)C(C)CN |
| InChI | InChI=1S/C9H21N3O/c1-8(7-10)12(3)6-4-5-9(13)11-2/h8H,4-7,10H2,1-3H3,(H,11,13) |
| InChIKey | MPMBFKWWBDKADR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |