C8H16N2O4 — CID 62335232
methyl N-[2-[2-hydroxypropyl(methyl)amino]acetyl]carbamate (PubChem CID 62335232) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl N-[2-[2-hydroxypropyl(methyl)amino]acetyl]carbamate.
| Compound Name | methyl N-[2-[2-hydroxypropyl(methyl)amino]acetyl]carbamate |
|---|---|
| PubChem CID | 62335232 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | methyl N-[2-[2-hydroxypropyl(methyl)amino]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CN(C)CC(C)O |
| InChI | InChI=1S/C8H16N2O4/c1-6(11)4-10(2)5-7(12)9-8(13)14-3/h6,11H,4-5H2,1-3H3,(H,9,12,13) |
| InChIKey | NEYFJZHCNQEDES-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |