C11H23N3O3 — CID 62334696
N-(butylcarbamoyl)-2-[2-hydroxypropyl(methyl)amino]acetamide (PubChem CID 62334696) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[2-hydroxypropyl(methyl)amino]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[2-hydroxypropyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 62334696 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | N-(butylcarbamoyl)-2-[2-hydroxypropyl(methyl)amino]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN(C)CC(C)O |
| InChI | InChI=1S/C11H23N3O3/c1-4-5-6-12-11(17)13-10(16)8-14(3)7-9(2)15/h9,15H,4-8H2,1-3H3,(H2,12,13,16,17) |
| InChIKey | LIAGWZXZOUEBPS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|