C11H23N3O4 — CID 146142232
2-[[3-hydroxy-2-(hydroxymethyl)propyl]-methylamino]-N-(propylcarbamoyl)acetamide (PubChem CID 146142232) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[[3-hydroxy-2-(hydroxymethyl)propyl]-methylamino]-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-[[3-hydroxy-2-(hydroxymethyl)propyl]-methylamino]-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 146142232 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[[3-hydroxy-2-(hydroxymethyl)propyl]-methylamino]-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CN(C)CC(CO)CO |
| InChI | InChI=1S/C11H23N3O4/c1-3-4-12-11(18)13-10(17)6-14(2)5-9(7-15)8-16/h9,15-16H,3-8H2,1-2H3,(H2,12,13,17,18) |
| InChIKey | UWEPHOKJWHZGNZ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |