C9H20N4O2 — CID 62688633
2-[2-aminoethyl(methyl)amino]-N-(propylcarbamoyl)acetamide (PubChem CID 62688633) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 62688633 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CN(C)CCN |
| InChI | InChI=1S/C9H20N4O2/c1-3-5-11-9(15)12-8(14)7-13(2)6-4-10/h3-7,10H2,1-2H3,(H2,11,12,14,15) |
| InChIKey | WQPIXYRKQYGGBU-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |