C10H23N3O — CID 61486750
2-[2-aminoethyl(methyl)amino]-N-pentan-3-ylacetamide (PubChem CID 61486750) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-pentan-3-ylacetamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 61486750 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CN(C)CCN |
| InChI | InChI=1S/C10H23N3O/c1-4-9(5-2)12-10(14)8-13(3)7-6-11/h9H,4-8,11H2,1-3H3,(H,12,14) |
| InChIKey | IKCBKGWZJXFBCC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |