C8H18N4O2 — CID 81493509
2-[3-aminopropyl(methyl)amino]-N-(methylcarbamoyl)acetamide (PubChem CID 81493509) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[3-aminopropyl(methyl)amino]-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-[3-aminopropyl(methyl)amino]-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 81493509 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[3-aminopropyl(methyl)amino]-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CN(C)CCCN |
| InChI | InChI=1S/C8H18N4O2/c1-10-8(14)11-7(13)6-12(2)5-3-4-9/h3-6,9H2,1-2H3,(H2,10,11,13,14) |
| InChIKey | IBMNMLVUAOXJHS-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |