C10H21N3O4 — CID 60686309
2-[bis(2-hydroxyethyl)amino]-N-(propylcarbamoyl)acetamide (PubChem CID 60686309) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 60686309 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CN(CCO)CCO |
| InChI | InChI=1S/C10H21N3O4/c1-2-3-11-10(17)12-9(16)8-13(4-6-14)5-7-15/h14-15H,2-8H2,1H3,(H2,11,12,16,17) |
| InChIKey | CIDHXIACXHVTRS-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |