C13H21N3O4 — CID 60691736
N-(furan-2-ylmethylcarbamoyl)-2-[2-hydroxyethyl(propyl)amino]acetamide (PubChem CID 60691736) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-[2-hydroxyethyl(propyl)amino]acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-[2-hydroxyethyl(propyl)amino]acetamide |
|---|---|
| PubChem CID | 60691736 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-[2-hydroxyethyl(propyl)amino]acetamide |
| SMILES | CCCN(CCO)CC(=O)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C13H21N3O4/c1-2-5-16(6-7-17)10-12(18)15-13(19)14-9-11-4-3-8-20-11/h3-4,8,17H,2,5-7,9-10H2,1H3,(H2,14,15,18,19) |
| InChIKey | KAPSPEDGEQBBJL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |