C11H17NO3 — CID 62053466
1-(furan-2-yl)-2-[2-hydroxyethyl(propyl)amino]ethanone (PubChem CID 62053466) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[2-hydroxyethyl(propyl)amino]ethanone.
| Compound Name | 1-(furan-2-yl)-2-[2-hydroxyethyl(propyl)amino]ethanone |
|---|---|
| PubChem CID | 62053466 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(furan-2-yl)-2-[2-hydroxyethyl(propyl)amino]ethanone |
| SMILES | CCCN(CCO)CC(=O)c1ccco1 |
| InChI | InChI=1S/C11H17NO3/c1-2-5-12(6-7-13)9-10(14)11-4-3-8-15-11/h3-4,8,13H,2,5-7,9H2,1H3 |
| InChIKey | QIGNXMUBCHLXMI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |