C17H21N3O4 — CID 51106343
N-(furan-2-ylmethylcarbamoyl)-2-[N-(2-hydroxypropyl)anilino]acetamide (PubChem CID 51106343) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-[N-(2-hydroxypropyl)anilino]acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-[N-(2-hydroxypropyl)anilino]acetamide |
|---|---|
| PubChem CID | 51106343 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-[N-(2-hydroxypropyl)anilino]acetamide |
| SMILES | CC(O)CN(CC(=O)NC(=O)NCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C17H21N3O4/c1-13(21)11-20(14-6-3-2-4-7-14)12-16(22)19-17(23)18-10-15-8-5-9-24-15/h2-9,13,21H,10-12H2,1H3,(H2,18,19,22,23) |
| InChIKey | DXVRAZHOSXDADB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |