C13H19N3O5 — CID 43631411
2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid (PubChem CID 43631411) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid.
| Compound Name | 2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43631411 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid |
| SMILES | CCCC(NCC(=O)NC(=O)NCc1ccco1)C(=O)O |
| InChI | InChI=1S/C13H19N3O5/c1-2-4-10(12(18)19)14-8-11(17)16-13(20)15-7-9-5-3-6-21-9/h3,5-6,10,14H,2,4,7-8H2,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | IXGYVZYYBUMVJB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |