C16H18ClN3O3 — CID 9306254
2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 9306254) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-N-(furan-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-N-(furan-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9306254 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | C[C@H](NCC(=O)NC(=O)NCc1ccco1)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c1-11(13-6-2-3-7-14(13)17)18-10-15(21)20-16(22)19-9-12-5-4-8-23-12/h2-8,11,18H,9-10H2,1H3,(H2,19,20,21,22)/t11-/m0/s1 |
| InChIKey | ZQLYAUGUMZLHGS-NSHDSACASA-N |
| XLogP | 2.61 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |