C9H17N3O4 — CID 43631818
2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid (PubChem CID 43631818) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid.
| Compound Name | 2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43631818 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]pentanoic acid |
| SMILES | CCCC(NCC(=O)NC(=O)NC)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-3-4-6(8(14)15)11-5-7(13)12-9(16)10-2/h6,11H,3-5H2,1-2H3,(H,14,15)(H2,10,12,13,16) |
| InChIKey | OLAZLZYWVILHLB-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |