C12H17N3O5 — CID 62637062
2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylamino]propanoic acid (PubChem CID 62637062) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylamino]propanoic acid.
| Compound Name | 2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62637062 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CC(=O)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H17N3O5/c1-8(11(17)18)15(2)7-10(16)14-12(19)13-6-9-4-3-5-20-9/h3-5,8H,6-7H2,1-2H3,(H,17,18)(H2,13,14,16,19) |
| InChIKey | QQFHJNTZYCLHCI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |