C14H18N3O4+ — CID 8919816
[(1S)-1-(furan-2-yl)ethyl]-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 8919816) has the molecular formula C14H18N3O4+ and a molecular weight of 292.31 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)ethyl]-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(furan-2-yl)ethyl]-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8919816 |
| Molecular Formula | C14H18N3O4+ |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [(1S)-1-(furan-2-yl)ethyl]-[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NC(=O)NCc1ccco1)c1ccco1 |
| InChI | InChI=1S/C14H17N3O4/c1-10(12-5-3-7-21-12)15-9-13(18)17-14(19)16-8-11-4-2-6-20-11/h2-7,10,15H,8-9H2,1H3,(H2,16,17,18,19)/p+1/t10-/m0/s1 |
| InChIKey | YWGQIKSYKOKYLA-JTQLQIEISA-O |
| XLogP | 0.52 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |